C5H9FN2O — CID 143942515
3-fluoro-N,4-dimethyl-1,3-oxazolidin-2-imine (PubChem CID 143942515) has the molecular formula C5H9FN2O and a molecular weight of 132.14 g/mol. Its IUPAC name is 3-fluoro-N,4-dimethyl-1,3-oxazolidin-2-imine.
| Compound Name | 3-fluoro-N,4-dimethyl-1,3-oxazolidin-2-imine |
|---|---|
| PubChem CID | 143942515 |
| Molecular Formula | C5H9FN2O |
| Molecular Weight | 132.14 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | 3-fluoro-N,4-dimethyl-1,3-oxazolidin-2-imine |
| SMILES | C/N=C1\OCC(C)N1F |
| InChI | InChI=1S/C5H9FN2O/c1-4-3-9-5(7-2)8(4)6/h4H,3H2,1-2H3/b7-5- |
| InChIKey | SALVYEWQFQIJET-ALCCZGGFSA-N |
| XLogP | 0.58 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.14 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|