About N-methyl-N-propan-2-yl-4,5-dihydro-1,3-oxazol-2-amine
N-methyl-N-propan-2-yl-4,5-dihydro-1,3-oxazol-2-amine (PubChem CID 156747941) has the molecular formula C7H14N2O
and a molecular weight of 142.20 g/mol. Its IUPAC name is N-methyl-N-propan-2-yl-4,5-dihydro-1,3-oxazol-2-amine.
Analyze N-methyl-N-propan-2-yl-4,5-dihydro-1,3-oxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-propan-2-yl-4,5-dihydro-1,3-oxazol-2-amine?
The IUPAC name of N-methyl-N-propan-2-yl-4,5-dihydro-1,3-oxazol-2-amine (CID 156747941) is N-methyl-N-propan-2-yl-4,5-dihydro-1,3-oxazol-2-amine.
What is the SMILES notation for N-methyl-N-propan-2-yl-4,5-dihydro-1,3-oxazol-2-amine?
The canonical SMILES for N-methyl-N-propan-2-yl-4,5-dihydro-1,3-oxazol-2-amine is CC(C)N(C)C1=NCCO1.
What is the InChIKey of N-methyl-N-propan-2-yl-4,5-dihydro-1,3-oxazol-2-amine?
The InChIKey is ZYISZRHNTFXHFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O/c1-6(2)9(3)7-8-4-5-10-7/h6H,4-5H2,1-3H3.
What are the key properties of N-methyl-N-propan-2-yl-4,5-dihydro-1,3-oxazol-2-amine?
N-methyl-N-propan-2-yl-4,5-dihydro-1,3-oxazol-2-amine has a molecular weight of 142.20 g/mol, XLogP of 0.71, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-propan-2-yl-4,5-dihydro-1,3-oxazol-2-amine is sourced from PubChem (CID 156747941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).