C7H14N2O — CID 12074436
N,N-diethyl-4,5-dihydro-1,3-oxazol-2-amine (PubChem CID 12074436) has the molecular formula C7H14N2O and a molecular weight of 142.20 g/mol. Its IUPAC name is N,N-diethyl-4,5-dihydro-1,3-oxazol-2-amine.
| Compound Name | N,N-diethyl-4,5-dihydro-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 12074436 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | N,N-diethyl-4,5-dihydro-1,3-oxazol-2-amine |
| SMILES | CCN(CC)C1=NCCO1 |
| InChI | InChI=1S/C7H14N2O/c1-3-9(4-2)7-8-5-6-10-7/h3-6H2,1-2H3 |
| InChIKey | SAMJYMQELVMMCT-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 24.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | 130 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |