C5H10N2O — CID 89200315
N,3-dimethyl-1,3-oxazolidin-2-imine (PubChem CID 89200315) has the molecular formula C5H10N2O and a molecular weight of 114.15 g/mol. Its IUPAC name is N,3-dimethyl-1,3-oxazolidin-2-imine.
| Compound Name | N,3-dimethyl-1,3-oxazolidin-2-imine |
|---|---|
| PubChem CID | 89200315 |
| Molecular Formula | C5H10N2O |
| Molecular Weight | 114.15 g/mol |
| Exact Mass | 114.08 |
| IUPAC Name | N,3-dimethyl-1,3-oxazolidin-2-imine |
| SMILES | C/N=C1\OCCN1C |
| InChI | InChI=1S/C5H10N2O/c1-6-5-7(2)3-4-8-5/h3-4H2,1-2H3/b6-5- |
| InChIKey | UHKNKIKXUOKLAU-WAYWQWQTSA-N |
| XLogP | -0.07 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.15 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|