C6H9N2O2+ — CID 57165115
2-(4,5-dihydro-1,3-oxazol-3-ium-3-yl)-4,5-dihydro-1,3-oxazole (PubChem CID 57165115) has the molecular formula C6H9N2O2+ and a molecular weight of 141.15 g/mol. Its IUPAC name is 2-(4,5-dihydro-1,3-oxazol-3-ium-3-yl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-(4,5-dihydro-1,3-oxazol-3-ium-3-yl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 57165115 |
| Molecular Formula | C6H9N2O2+ |
| Molecular Weight | 141.15 g/mol |
| Exact Mass | 141.07 |
| IUPAC Name | 2-(4,5-dihydro-1,3-oxazol-3-ium-3-yl)-4,5-dihydro-1,3-oxazole |
| SMILES | C1=[N+](C2=NCCO2)CCO1 |
| InChI | InChI=1S/C6H9N2O2/c1-3-10-6(7-1)8-2-4-9-5-8/h5H,1-4H2/q+1 |
| InChIKey | MNIPGAAJHPKELJ-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 33.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.15 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|