C6H14N2O — CID 90250322
N-(2-methoxyethyl)-N,N'-dimethylmethanimidamide (PubChem CID 90250322) has the molecular formula C6H14N2O and a molecular weight of 130.19 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N,N'-dimethylmethanimidamide.
| Compound Name | N-(2-methoxyethyl)-N,N'-dimethylmethanimidamide |
|---|---|
| PubChem CID | 90250322 |
| Molecular Formula | C6H14N2O |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.11 |
| IUPAC Name | N-(2-methoxyethyl)-N,N'-dimethylmethanimidamide |
| SMILES | C/N=C/N(C)CCOC |
| InChI | InChI=1S/C6H14N2O/c1-7-6-8(2)4-5-9-3/h6H,4-5H2,1-3H3/b7-6+ |
| InChIKey | XXPCADQHSLHVIF-VOTSOKGWSA-N |
| XLogP | 0.22 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|