About 2-(4,5-Dihydroimidazol-1-yl)-4,5-dihydro-1,3-oxazole
2-(4,5-Dihydroimidazol-1-yl)-4,5-dihydro-1,3-oxazole (PubChem CID 57009020) has the molecular formula C6H9N3O
and a molecular weight of 139.16 g/mol. Its IUPAC name is 2-(4,5-dihydroimidazol-1-yl)-4,5-dihydro-1,3-oxazole.
Analyze 2-(4,5-Dihydroimidazol-1-yl)-4,5-dihydro-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-Dihydroimidazol-1-yl)-4,5-dihydro-1,3-oxazole?
The IUPAC name of 2-(4,5-Dihydroimidazol-1-yl)-4,5-dihydro-1,3-oxazole (CID 57009020) is 2-(4,5-dihydroimidazol-1-yl)-4,5-dihydro-1,3-oxazole.
What is the SMILES notation for 2-(4,5-Dihydroimidazol-1-yl)-4,5-dihydro-1,3-oxazole?
The canonical SMILES for 2-(4,5-Dihydroimidazol-1-yl)-4,5-dihydro-1,3-oxazole is C1CN(C=N1)C2=NCCO2.
What is the InChIKey of 2-(4,5-Dihydroimidazol-1-yl)-4,5-dihydro-1,3-oxazole?
The InChIKey is HKQRMXICPBGWJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O/c1-3-9(5-7-1)6-8-2-4-10-6/h5H,1-4H2.
What are the key properties of 2-(4,5-Dihydroimidazol-1-yl)-4,5-dihydro-1,3-oxazole?
2-(4,5-Dihydroimidazol-1-yl)-4,5-dihydro-1,3-oxazole has a molecular weight of 139.16 g/mol, XLogP of -0.70, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-Dihydroimidazol-1-yl)-4,5-dihydro-1,3-oxazole is sourced from PubChem (CID 57009020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).