C8H17N3O2 — CID 103534605
3,4-dimethoxy-N'-methylpyrrolidine-1-carboximidamide (PubChem CID 103534605) has the molecular formula C8H17N3O2 and a molecular weight of 187.24 g/mol. Its IUPAC name is 3,4-dimethoxy-N'-methylpyrrolidine-1-carboximidamide.
| Compound Name | 3,4-dimethoxy-N'-methylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 103534605 |
| Molecular Formula | C8H17N3O2 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.13 |
| IUPAC Name | 3,4-dimethoxy-N'-methylpyrrolidine-1-carboximidamide |
| SMILES | C/N=C(\N)N1CC(OC)C(OC)C1 |
| InChI | InChI=1S/C8H17N3O2/c1-10-8(9)11-4-6(12-2)7(5-11)13-3/h6-7H,4-5H2,1-3H3,(H2,9,10) |
| InChIKey | QCWPUUAPPWDKQY-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|