C8H17N2O+ — CID 23261329
(3-ethyl-5-methyl-1,3-oxazolidin-2-ylidene)-dimethylazanium (PubChem CID 23261329) has the molecular formula C8H17N2O+ and a molecular weight of 157.24 g/mol. Its IUPAC name is (3-ethyl-5-methyl-1,3-oxazolidin-2-ylidene)-dimethylazanium.
| Compound Name | (3-ethyl-5-methyl-1,3-oxazolidin-2-ylidene)-dimethylazanium |
|---|---|
| PubChem CID | 23261329 |
| Molecular Formula | C8H17N2O+ |
| Molecular Weight | 157.24 g/mol |
| Exact Mass | 157.13 |
| IUPAC Name | (3-ethyl-5-methyl-1,3-oxazolidin-2-ylidene)-dimethylazanium |
| SMILES | CCN1CC(C)OC1=[N+](C)C |
| InChI | InChI=1S/C8H17N2O/c1-5-10-6-7(2)11-8(10)9(3)4/h7H,5-6H2,1-4H3/q+1 |
| InChIKey | YPGFGVVMNXUOSU-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 15.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.24 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|