C12H24N2O4S — CID 103535343
3-[(3,4-dimethoxypyrrolidin-1-yl)sulfonylmethyl]piperidine (PubChem CID 103535343) has the molecular formula C12H24N2O4S and a molecular weight of 292.40 g/mol. Its IUPAC name is 3-[(3,4-dimethoxypyrrolidin-1-yl)sulfonylmethyl]piperidine.
| Compound Name | 3-[(3,4-dimethoxypyrrolidin-1-yl)sulfonylmethyl]piperidine |
|---|---|
| PubChem CID | 103535343 |
| Molecular Formula | C12H24N2O4S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 3-[(3,4-dimethoxypyrrolidin-1-yl)sulfonylmethyl]piperidine |
| SMILES | COC1CN(S(=O)(=O)CC2CCCNC2)CC1OC |
| InChI | InChI=1S/C12H24N2O4S/c1-17-11-7-14(8-12(11)18-2)19(15,16)9-10-4-3-5-13-6-10/h10-13H,3-9H2,1-2H3 |
| InChIKey | DMWPHOYHQNDPIA-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |