C11H22N2O2S2 — CID 54972395
4-(piperidin-3-ylmethylsulfonyl)-1,4-thiazepane (PubChem CID 54972395) has the molecular formula C11H22N2O2S2 and a molecular weight of 278.44 g/mol. Its IUPAC name is 4-(piperidin-3-ylmethylsulfonyl)-1,4-thiazepane.
| Compound Name | 4-(piperidin-3-ylmethylsulfonyl)-1,4-thiazepane |
|---|---|
| PubChem CID | 54972395 |
| Molecular Formula | C11H22N2O2S2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 4-(piperidin-3-ylmethylsulfonyl)-1,4-thiazepane |
| SMILES | O=S(=O)(CC1CCCNC1)N1CCCSCC1 |
| InChI | InChI=1S/C11H22N2O2S2/c14-17(15,10-11-3-1-4-12-9-11)13-5-2-7-16-8-6-13/h11-12H,1-10H2 |
| InChIKey | DWGLKDDFFVAOHU-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |