C8H17NO6 — CID 10353540
(2R,3R,4S,5S)-2-[(1R,2R)-1,2,3-trihydroxypropyl]piperidine-3,4,5-triol (PubChem CID 10353540) has the molecular formula C8H17NO6 and a molecular weight of 223.22 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-[(1R,2R)-1,2,3-trihydroxypropyl]piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S)-2-[(1R,2R)-1,2,3-trihydroxypropyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 10353540 |
| Molecular Formula | C8H17NO6 |
| Molecular Weight | 223.22 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | (2R,3R,4S,5S)-2-[(1R,2R)-1,2,3-trihydroxypropyl]piperidine-3,4,5-triol |
| SMILES | OC[C@@H](O)[C@H](O)[C@H]1NC[C@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H17NO6/c10-2-4(12)6(13)5-8(15)7(14)3(11)1-9-5/h3-15H,1-2H2/t3-,4+,5+,6-,7-,8+/m0/s1 |
| InChIKey | GEVFHNLSGFMPMF-DTULTOMQSA-N |
| XLogP | -4.24 |
| TPSA | 133.41 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.22 |
| LogP ≤ 5 | -4.24 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |