C11H16ClN3O2 — CID 103536649
4-chloro-6-(3,4-dimethoxypyrrolidin-1-yl)-5-methylpyrimidine (PubChem CID 103536649) has the molecular formula C11H16ClN3O2 and a molecular weight of 257.72 g/mol. Its IUPAC name is 4-chloro-6-(3,4-dimethoxypyrrolidin-1-yl)-5-methylpyrimidine.
| Compound Name | 4-chloro-6-(3,4-dimethoxypyrrolidin-1-yl)-5-methylpyrimidine |
|---|---|
| PubChem CID | 103536649 |
| Molecular Formula | C11H16ClN3O2 |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 4-chloro-6-(3,4-dimethoxypyrrolidin-1-yl)-5-methylpyrimidine |
| SMILES | COC1CN(c2ncnc(Cl)c2C)CC1OC |
| InChI | InChI=1S/C11H16ClN3O2/c1-7-10(12)13-6-14-11(7)15-4-8(16-2)9(5-15)17-3/h6,8-9H,4-5H2,1-3H3 |
| InChIKey | PRWVTQHBCWWPJS-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |