C12H18ClN3O2 — CID 103536691
4-chloro-6-(3,4-dimethoxypyrrolidin-1-yl)-5-ethylpyrimidine (PubChem CID 103536691) has the molecular formula C12H18ClN3O2 and a molecular weight of 271.75 g/mol. Its IUPAC name is 4-chloro-6-(3,4-dimethoxypyrrolidin-1-yl)-5-ethylpyrimidine.
| Compound Name | 4-chloro-6-(3,4-dimethoxypyrrolidin-1-yl)-5-ethylpyrimidine |
|---|---|
| PubChem CID | 103536691 |
| Molecular Formula | C12H18ClN3O2 |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 4-chloro-6-(3,4-dimethoxypyrrolidin-1-yl)-5-ethylpyrimidine |
| SMILES | CCc1c(Cl)ncnc1N1CC(OC)C(OC)C1 |
| InChI | InChI=1S/C12H18ClN3O2/c1-4-8-11(13)14-7-15-12(8)16-5-9(17-2)10(6-16)18-3/h7,9-10H,4-6H2,1-3H3 |
| InChIKey | UTCMNTKCPDOORT-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |