C13H24N2O3 — CID 103537978
methyl 2-(cyclopropylamino)-3-(3-methoxypyrrolidin-1-yl)-2-methylpropanoate (PubChem CID 103537978) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is methyl 2-(cyclopropylamino)-3-(3-methoxypyrrolidin-1-yl)-2-methylpropanoate.
| Compound Name | methyl 2-(cyclopropylamino)-3-(3-methoxypyrrolidin-1-yl)-2-methylpropanoate |
|---|---|
| PubChem CID | 103537978 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | methyl 2-(cyclopropylamino)-3-(3-methoxypyrrolidin-1-yl)-2-methylpropanoate |
| SMILES | COC(=O)C(C)(CN1CCC(OC)C1)NC1CC1 |
| InChI | InChI=1S/C13H24N2O3/c1-13(12(16)18-3,14-10-4-5-10)9-15-7-6-11(8-15)17-2/h10-11,14H,4-9H2,1-3H3 |
| InChIKey | NZQJHNWRSNMOEN-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |