C17H24N2OS — CID 103539725
N-[[3-[(3-methoxypyrrolidin-1-yl)methyl]-1-benzothiophen-2-yl]methyl]ethanamine (PubChem CID 103539725) has the molecular formula C17H24N2OS and a molecular weight of 304.46 g/mol. Its IUPAC name is N-[[3-[(3-methoxypyrrolidin-1-yl)methyl]-1-benzothiophen-2-yl]methyl]ethanamine.
| Compound Name | N-[[3-[(3-methoxypyrrolidin-1-yl)methyl]-1-benzothiophen-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 103539725 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | N-[[3-[(3-methoxypyrrolidin-1-yl)methyl]-1-benzothiophen-2-yl]methyl]ethanamine |
| SMILES | CCNCc1sc2ccccc2c1CN1CCC(OC)C1 |
| InChI | InChI=1S/C17H24N2OS/c1-3-18-10-17-15(12-19-9-8-13(11-19)20-2)14-6-4-5-7-16(14)21-17/h4-7,13,18H,3,8-12H2,1-2H3 |
| InChIKey | LWMYPNQHHNVDKL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |