C17H25NOS — CID 62450074
N-[[3-(pentoxymethyl)-1-benzothiophen-2-yl]methyl]ethanamine (PubChem CID 62450074) has the molecular formula C17H25NOS and a molecular weight of 291.46 g/mol. Its IUPAC name is N-[[3-(pentoxymethyl)-1-benzothiophen-2-yl]methyl]ethanamine.
| Compound Name | N-[[3-(pentoxymethyl)-1-benzothiophen-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 62450074 |
| Molecular Formula | C17H25NOS |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | N-[[3-(pentoxymethyl)-1-benzothiophen-2-yl]methyl]ethanamine |
| SMILES | CCCCCOCc1c(CNCC)sc2ccccc12 |
| InChI | InChI=1S/C17H25NOS/c1-3-5-8-11-19-13-15-14-9-6-7-10-16(14)20-17(15)12-18-4-2/h6-7,9-10,18H,3-5,8,11-13H2,1-2H3 |
| InChIKey | IJELRIDFPDTDKN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|