C11H24N2O2 — CID 103539835
2-(3,4-dimethoxypyrrolidin-1-yl)-N-ethylpropan-1-amine (PubChem CID 103539835) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is 2-(3,4-dimethoxypyrrolidin-1-yl)-N-ethylpropan-1-amine.
| Compound Name | 2-(3,4-dimethoxypyrrolidin-1-yl)-N-ethylpropan-1-amine |
|---|---|
| PubChem CID | 103539835 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | 2-(3,4-dimethoxypyrrolidin-1-yl)-N-ethylpropan-1-amine |
| SMILES | CCNCC(C)N1CC(OC)C(OC)C1 |
| InChI | InChI=1S/C11H24N2O2/c1-5-12-6-9(2)13-7-10(14-3)11(8-13)15-4/h9-12H,5-8H2,1-4H3 |
| InChIKey | LSFDAMJIMBOXJA-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |