C11H18N4O — CID 103541803
6-(3-methoxypyrrolidin-1-yl)-N,2-dimethylpyrimidin-4-amine (PubChem CID 103541803) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is 6-(3-methoxypyrrolidin-1-yl)-N,2-dimethylpyrimidin-4-amine.
| Compound Name | 6-(3-methoxypyrrolidin-1-yl)-N,2-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 103541803 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 6-(3-methoxypyrrolidin-1-yl)-N,2-dimethylpyrimidin-4-amine |
| SMILES | CNc1cc(N2CCC(OC)C2)nc(C)n1 |
| InChI | InChI=1S/C11H18N4O/c1-8-13-10(12-2)6-11(14-8)15-5-4-9(7-15)16-3/h6,9H,4-5,7H2,1-3H3,(H,12,13,14) |
| InChIKey | MIXNDBCNKOGVGW-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |