C12H19N3O — CID 154661534
2-[(3S)-3-methoxypyrrolidin-1-yl]-N,6-dimethylpyridin-4-amine (PubChem CID 154661534) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-[(3S)-3-methoxypyrrolidin-1-yl]-N,6-dimethylpyridin-4-amine.
| Compound Name | 2-[(3S)-3-methoxypyrrolidin-1-yl]-N,6-dimethylpyridin-4-amine |
|---|---|
| PubChem CID | 154661534 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 2-[(3S)-3-methoxypyrrolidin-1-yl]-N,6-dimethylpyridin-4-amine |
| SMILES | CNc1cc(C)nc(N2CC[C@H](OC)C2)c1 |
| InChI | InChI=1S/C12H19N3O/c1-9-6-10(13-2)7-12(14-9)15-5-4-11(8-15)16-3/h6-7,11H,4-5,8H2,1-3H3,(H,13,14)/t11-/m0/s1 |
| InChIKey | CMBVBYGHUZNLBH-NSHDSACASA-N |
| XLogP | 1.66 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |