C13H15N5O3 — CID 103543064
6-amino-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 103543064) has the molecular formula C13H15N5O3 and a molecular weight of 289.30 g/mol. Its IUPAC name is 6-amino-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | 6-amino-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 103543064 |
| Molecular Formula | C13H15N5O3 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 6-amino-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | CC(NC(=O)c1cc2c(cc1N)OCO2)c1nncn1C |
| InChI | InChI=1S/C13H15N5O3/c1-7(12-17-15-5-18(12)2)16-13(19)8-3-10-11(4-9(8)14)21-6-20-10/h3-5,7H,6,14H2,1-2H3,(H,16,19) |
| InChIKey | GFRBWCBTJLHBNA-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|