methyl (Z)-2,3-dimethyl-5-(oxan-2-yloxy)pent-2-enoate

C13H22O4 — CID 10354383

IUPACmethyl (Z)-2,3-dimethyl-5-(oxan-2-yloxy)pent-2-enoate
SMILESCOC(=O)/C(C)=C(/C)CCOC1CCCCO1
InChIInChI=1S/C13H22O4/c1-10(11(2)13(14)15-3)7-9-17-12-6-4-5-8-16-12/h12H,4-9H2,1-3H3/b11-10-
InChIKeyCNWUGNUXASQZJM-KHPPLWFESA-N
MW242.31 g/mol
LogP2.43
Rot. Bonds5

About methyl (Z)-2,3-dimethyl-5-(oxan-2-yloxy)pent-2-enoate

methyl (Z)-2,3-dimethyl-5-(oxan-2-yloxy)pent-2-enoate (PubChem CID 10354383) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is methyl (Z)-2,3-dimethyl-5-(oxan-2-yloxy)pent-2-enoate.

Molecular Properties

Compound Namemethyl (Z)-2,3-dimethyl-5-(oxan-2-yloxy)pent-2-enoate
PubChem CID10354383
Molecular FormulaC13H22O4
Molecular Weight242.31 g/mol
Exact Mass242.15
IUPAC Namemethyl (Z)-2,3-dimethyl-5-(oxan-2-yloxy)pent-2-enoate
SMILESCOC(=O)/C(C)=C(/C)CCOC1CCCCO1
InChIInChI=1S/C13H22O4/c1-10(11(2)13(14)15-3)7-9-17-12-6-4-5-8-16-12/h12H,4-9H2,1-3H3/b11-10-
InChIKeyCNWUGNUXASQZJM-KHPPLWFESA-N
XLogP2.43
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.31
LogP ≤ 52.43
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl (Z)-2,3-dimethyl-5-(oxan-2-yloxy)pent-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (Z)-2,3-dimethyl-5-(oxan-2-yloxy)pent-2-enoate?
The IUPAC name of methyl (Z)-2,3-dimethyl-5-(oxan-2-yloxy)pent-2-enoate (CID 10354383) is methyl (Z)-2,3-dimethyl-5-(oxan-2-yloxy)pent-2-enoate.
What is the SMILES notation for methyl (Z)-2,3-dimethyl-5-(oxan-2-yloxy)pent-2-enoate?
The canonical SMILES for methyl (Z)-2,3-dimethyl-5-(oxan-2-yloxy)pent-2-enoate is COC(=O)/C(C)=C(/C)CCOC1CCCCO1.
What is the InChIKey of methyl (Z)-2,3-dimethyl-5-(oxan-2-yloxy)pent-2-enoate?
The InChIKey is CNWUGNUXASQZJM-KHPPLWFESA-N. The full InChI is InChI=1S/C13H22O4/c1-10(11(2)13(14)15-3)7-9-17-12-6-4-5-8-16-12/h12H,4-9H2,1-3H3/b11-10-.
What are the key properties of methyl (Z)-2,3-dimethyl-5-(oxan-2-yloxy)pent-2-enoate?
methyl (Z)-2,3-dimethyl-5-(oxan-2-yloxy)pent-2-enoate has a molecular weight of 242.31 g/mol, XLogP of 2.43, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (Z)-2,3-dimethyl-5-(oxan-2-yloxy)pent-2-enoate is sourced from PubChem (CID 10354383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).