C35H70O4Sn2 — CID 134865802
methyl (Z)-5-(oxan-2-yloxy)-2,3-bis(tributylstannyl)pent-2-enoate (PubChem CID 134865802) has the molecular formula C35H70O4Sn2 and a molecular weight of 792.36 g/mol. Its IUPAC name is methyl (Z)-5-(oxan-2-yloxy)-2,3-bis(tributylstannyl)pent-2-enoate.
| Compound Name | methyl (Z)-5-(oxan-2-yloxy)-2,3-bis(tributylstannyl)pent-2-enoate |
|---|---|
| PubChem CID | 134865802 |
| Molecular Formula | C35H70O4Sn2 |
| Molecular Weight | 792.36 g/mol |
| Exact Mass | 794.33 |
| IUPAC Name | methyl (Z)-5-(oxan-2-yloxy)-2,3-bis(tributylstannyl)pent-2-enoate |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(CCOC1CCCCO1)=C(/C(=O)OC)[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C11H16O4.6C4H9.2Sn/c1-13-10(12)6-2-4-8-14-11-7-3-5-9-15-11;6*1-3-4-2;;/h11H,3-5,7-9H2,1H3;6*1,3-4H2,2H3;; |
| InChIKey | LFJXLDCEZORMSW-UHFFFAOYSA-N |
| XLogP | 11.17 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.36 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|