C27H50O4Sn — CID 10053611
ethyl (2E)-8-(oxan-2-yloxy)-6-tributylstannylocta-2,6-dienoate (PubChem CID 10053611) has the molecular formula C27H50O4Sn and a molecular weight of 557.40 g/mol. Its IUPAC name is ethyl (2E)-8-(oxan-2-yloxy)-6-tributylstannylocta-2,6-dienoate.
| Compound Name | ethyl (2E)-8-(oxan-2-yloxy)-6-tributylstannylocta-2,6-dienoate |
|---|---|
| PubChem CID | 10053611 |
| Molecular Formula | C27H50O4Sn |
| Molecular Weight | 557.40 g/mol |
| Exact Mass | 558.27 |
| IUPAC Name | ethyl (2E)-8-(oxan-2-yloxy)-6-tributylstannylocta-2,6-dienoate |
| SMILES | CCCC[Sn](CCCC)(CCCC)C(=CCOC1CCCCO1)CC/C=C/C(=O)OCC |
| InChI | InChI=1S/C15H23O4.3C4H9.Sn/c1-2-17-14(16)10-6-4-3-5-8-12-18-15-11-7-9-13-19-15;3*1-3-4-2;/h6,8,10,15H,2-4,7,9,11-13H2,1H3;3*1,3-4H2,2H3;/b8-5?,10-6+;;;; |
| InChIKey | DFSLLSCVEWBKSV-HZKYVPOESA-N |
| XLogP | 7.74 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.40 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|