C22H42O4Sn — CID 11081459
methyl (E)-4-(oxan-2-yloxy)-3-tributylstannylbut-2-enoate (PubChem CID 11081459) has the molecular formula C22H42O4Sn and a molecular weight of 489.29 g/mol. Its IUPAC name is methyl (E)-4-(oxan-2-yloxy)-3-tributylstannylbut-2-enoate.
| Compound Name | methyl (E)-4-(oxan-2-yloxy)-3-tributylstannylbut-2-enoate |
|---|---|
| PubChem CID | 11081459 |
| Molecular Formula | C22H42O4Sn |
| Molecular Weight | 489.29 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | methyl (E)-4-(oxan-2-yloxy)-3-tributylstannylbut-2-enoate |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(=C/C(=O)OC)COC1CCCCO1 |
| InChI | InChI=1S/C10H15O4.3C4H9.Sn/c1-12-9(11)5-4-8-14-10-6-2-3-7-13-10;3*1-3-4-2;/h5,10H,2-3,6-8H2,1H3;3*1,3-4H2,2H3; |
| InChIKey | YDWIIXKDBZRPCK-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.29 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|