About methyl (Z)-4-(oxan-2-yloxy)-2,3-bis(tributylstannyl)but-2-enoate
methyl (Z)-4-(oxan-2-yloxy)-2,3-bis(tributylstannyl)but-2-enoate (PubChem CID 10676696) has the molecular formula C34H68O4Sn2
and a molecular weight of 778.34 g/mol. Its IUPAC name is methyl (Z)-4-(oxan-2-yloxy)-2,3-bis(tributylstannyl)but-2-enoate.
Molecular Properties
| Compound Name | methyl (Z)-4-(oxan-2-yloxy)-2,3-bis(tributylstannyl)but-2-enoate |
| PubChem CID | 10676696 |
| Molecular Formula | C34H68O4Sn2 |
| Molecular Weight | 778.34 g/mol |
| Exact Mass | 780.32 |
| IUPAC Name | methyl (Z)-4-(oxan-2-yloxy)-2,3-bis(tributylstannyl)but-2-enoate |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(COC1CCCCO1)=C(/C(=O)OC)[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C10H14O4.6C4H9.2Sn/c1-12-9(11)5-4-8-14-10-6-2-3-7-13-10;6*1-3-4-2;;/h10H,2-3,6-8H2,1H3;6*1,3-4H2,2H3;; |
| InChIKey | HBJQZWVEGCXZDT-UHFFFAOYSA-N |
| XLogP | 10.78 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 778.34 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (Z)-4-(oxan-2-yloxy)-2,3-bis(tributylstannyl)but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (Z)-4-(oxan-2-yloxy)-2,3-bis(tributylstannyl)but-2-enoate?
The IUPAC name of methyl (Z)-4-(oxan-2-yloxy)-2,3-bis(tributylstannyl)but-2-enoate (CID 10676696) is methyl (Z)-4-(oxan-2-yloxy)-2,3-bis(tributylstannyl)but-2-enoate.
What is the SMILES notation for methyl (Z)-4-(oxan-2-yloxy)-2,3-bis(tributylstannyl)but-2-enoate?
The canonical SMILES for methyl (Z)-4-(oxan-2-yloxy)-2,3-bis(tributylstannyl)but-2-enoate is CCCC[Sn](CCCC)(CCCC)/C(COC1CCCCO1)=C(/C(=O)OC)[Sn](CCCC)(CCCC)CCCC.
What is the InChIKey of methyl (Z)-4-(oxan-2-yloxy)-2,3-bis(tributylstannyl)but-2-enoate?
The InChIKey is HBJQZWVEGCXZDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O4.6C4H9.2Sn/c1-12-9(11)5-4-8-14-10-6-2-3-7-13-10;6*1-3-4-2;;/h10H,2-3,6-8H2,1H3;6*1,3-4H2,2H3;;.
What are the key properties of methyl (Z)-4-(oxan-2-yloxy)-2,3-bis(tributylstannyl)but-2-enoate?
methyl (Z)-4-(oxan-2-yloxy)-2,3-bis(tributylstannyl)but-2-enoate has a molecular weight of 778.34 g/mol, XLogP of 10.78, 24 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (Z)-4-(oxan-2-yloxy)-2,3-bis(tributylstannyl)but-2-enoate is sourced from PubChem (CID 10676696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).