C14H18O4 — CID 10977872
methyl (2Z,6E)-8-(oxan-2-yloxy)octa-2,6-dien-4-ynoate (PubChem CID 10977872) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is methyl (2Z,6E)-8-(oxan-2-yloxy)octa-2,6-dien-4-ynoate.
| Compound Name | methyl (2Z,6E)-8-(oxan-2-yloxy)octa-2,6-dien-4-ynoate |
|---|---|
| PubChem CID | 10977872 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | methyl (2Z,6E)-8-(oxan-2-yloxy)octa-2,6-dien-4-ynoate |
| SMILES | COC(=O)/C=C\C#C/C=C/COC1CCCCO1 |
| InChI | InChI=1S/C14H18O4/c1-16-13(15)9-5-3-2-4-7-11-17-14-10-6-8-12-18-14/h4-5,7,9,14H,6,8,10-12H2,1H3/b7-4+,9-5- |
| InChIKey | BHRMQOJSFVMSSD-HQHVODAESA-N |
| XLogP | 1.82 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|