C26H40O8 — CID 11826942
(3E,5S,8R,11E,13S,16R)-8,16-dimethyl-5,13-bis(oxan-2-yloxy)-1,9-dioxacyclohexadeca-3,11-diene-2,10-dione (PubChem CID 11826942) has the molecular formula C26H40O8 and a molecular weight of 480.60 g/mol. Its IUPAC name is (3E,5S,8R,11E,13S,16R)-8,16-dimethyl-5,13-bis(oxan-2-yloxy)-1,9-dioxacyclohexadeca-3,11-diene-2,10-dione.
| Compound Name | (3E,5S,8R,11E,13S,16R)-8,16-dimethyl-5,13-bis(oxan-2-yloxy)-1,9-dioxacyclohexadeca-3,11-diene-2,10-dione |
|---|---|
| PubChem CID | 11826942 |
| Molecular Formula | C26H40O8 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | (3E,5S,8R,11E,13S,16R)-8,16-dimethyl-5,13-bis(oxan-2-yloxy)-1,9-dioxacyclohexadeca-3,11-diene-2,10-dione |
| SMILES | C[C@@H]1CC[C@H](OC2CCCCO2)/C=C/C(=O)O[C@H](C)CC[C@H](OC2CCCCO2)/C=C/C(=O)O1 |
| InChI | InChI=1S/C26H40O8/c1-19-9-11-21(33-25-7-3-5-17-29-25)14-16-24(28)32-20(2)10-12-22(13-15-23(27)31-19)34-26-8-4-6-18-30-26/h13-16,19-22,25-26H,3-12,17-18H2,1-2H3/b15-13+,16-14+/t19-,20-,21+,22+,25?,26?/m1/s1 |
| InChIKey | IJESEUYHKIUFHC-BDMGFSFSSA-N |
| XLogP | 4.36 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |