C13H22O5 — CID 11032567
(E,4S,7S)-7-hydroxy-4-(oxan-2-yloxy)oct-2-enoic acid (PubChem CID 11032567) has the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. Its IUPAC name is (E,4S,7S)-7-hydroxy-4-(oxan-2-yloxy)oct-2-enoic acid.
| Compound Name | (E,4S,7S)-7-hydroxy-4-(oxan-2-yloxy)oct-2-enoic acid |
|---|---|
| PubChem CID | 11032567 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | (E,4S,7S)-7-hydroxy-4-(oxan-2-yloxy)oct-2-enoic acid |
| SMILES | C[C@H](O)CC[C@@H](/C=C/C(=O)O)OC1CCCCO1 |
| InChI | InChI=1S/C13H22O5/c1-10(14)5-6-11(7-8-12(15)16)18-13-4-2-3-9-17-13/h7-8,10-11,13-14H,2-6,9H2,1H3,(H,15,16)/b8-7+/t10-,11-,13?/m0/s1 |
| InChIKey | MFRYNGVEMFMTPV-BFXDQJSCSA-N |
| XLogP | 1.70 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|