C23H38O4 — CID 54219072
propan-2-yl 3,7,11-trimethyl-10-(oxan-2-yloxy)dodeca-2,6,11-trienoate (PubChem CID 54219072) has the molecular formula C23H38O4 and a molecular weight of 378.55 g/mol. Its IUPAC name is propan-2-yl 3,7,11-trimethyl-10-(oxan-2-yloxy)dodeca-2,6,11-trienoate.
| Compound Name | propan-2-yl 3,7,11-trimethyl-10-(oxan-2-yloxy)dodeca-2,6,11-trienoate |
|---|---|
| PubChem CID | 54219072 |
| Molecular Formula | C23H38O4 |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.28 |
| IUPAC Name | propan-2-yl 3,7,11-trimethyl-10-(oxan-2-yloxy)dodeca-2,6,11-trienoate |
| SMILES | C=C(C)C(CCC(C)=CCCC(C)=CC(=O)OC(C)C)OC1CCCCO1 |
| InChI | InChI=1S/C23H38O4/c1-17(2)21(27-23-12-7-8-15-25-23)14-13-19(5)10-9-11-20(6)16-22(24)26-18(3)4/h10,16,18,21,23H,1,7-9,11-15H2,2-6H3 |
| InChIKey | QBFYFRUFXNLJGU-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|