C18H32O4 — CID 10519209
ethyl (E)-3-[(2S,4R,6S)-6-hexyl-2-propan-2-yl-1,3-dioxan-4-yl]prop-2-enoate (PubChem CID 10519209) has the molecular formula C18H32O4 and a molecular weight of 312.45 g/mol. Its IUPAC name is ethyl (E)-3-[(2S,4R,6S)-6-hexyl-2-propan-2-yl-1,3-dioxan-4-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(2S,4R,6S)-6-hexyl-2-propan-2-yl-1,3-dioxan-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 10519209 |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | ethyl (E)-3-[(2S,4R,6S)-6-hexyl-2-propan-2-yl-1,3-dioxan-4-yl]prop-2-enoate |
| SMILES | CCCCCC[C@H]1C[C@H](/C=C/C(=O)OCC)O[C@@H](C(C)C)O1 |
| InChI | InChI=1S/C18H32O4/c1-5-7-8-9-10-15-13-16(11-12-17(19)20-6-2)22-18(21-15)14(3)4/h11-12,14-16,18H,5-10,13H2,1-4H3/b12-11+/t15-,16-,18-/m0/s1 |
| InChIKey | KIILHZWFERZEGM-QRVYWQKKSA-N |
| XLogP | 4.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|