C16H28O5 — CID 135006288
ethyl (E,4R)-4-cyclohexyl-4-(2-methoxyethoxymethoxy)but-2-enoate (PubChem CID 135006288) has the molecular formula C16H28O5 and a molecular weight of 300.40 g/mol. Its IUPAC name is ethyl (E,4R)-4-cyclohexyl-4-(2-methoxyethoxymethoxy)but-2-enoate.
| Compound Name | ethyl (E,4R)-4-cyclohexyl-4-(2-methoxyethoxymethoxy)but-2-enoate |
|---|---|
| PubChem CID | 135006288 |
| Molecular Formula | C16H28O5 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | ethyl (E,4R)-4-cyclohexyl-4-(2-methoxyethoxymethoxy)but-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](OCOCCOC)C1CCCCC1 |
| InChI | InChI=1S/C16H28O5/c1-3-20-16(17)10-9-15(14-7-5-4-6-8-14)21-13-19-12-11-18-2/h9-10,14-15H,3-8,11-13H2,1-2H3/b10-9+/t15-/m0/s1 |
| InChIKey | MBPDBWRDNBXEIE-FEAKQIBJSA-N |
| XLogP | 2.69 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|