C18H30O6 — CID 74029337
(3-acetyloxy-6-octoxy-3,6-dihydro-2H-pyran-2-yl)methyl acetate (PubChem CID 74029337) has the molecular formula C18H30O6 and a molecular weight of 342.43 g/mol. Its IUPAC name is (3-acetyloxy-6-octoxy-3,6-dihydro-2H-pyran-2-yl)methyl acetate.
| Compound Name | (3-acetyloxy-6-octoxy-3,6-dihydro-2H-pyran-2-yl)methyl acetate |
|---|---|
| PubChem CID | 74029337 |
| Molecular Formula | C18H30O6 |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | (3-acetyloxy-6-octoxy-3,6-dihydro-2H-pyran-2-yl)methyl acetate |
| SMILES | CCCCCCCCOC1C=CC(OC(C)=O)C(COC(C)=O)O1 |
| InChI | InChI=1S/C18H30O6/c1-4-5-6-7-8-9-12-21-18-11-10-16(23-15(3)20)17(24-18)13-22-14(2)19/h10-11,16-18H,4-9,12-13H2,1-3H3 |
| InChIKey | PIHBYFAVQYXNJJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|