C17H30O4 — CID 71725462
ethyl (E)-4-[(4S,6R)-2,2-dimethyl-6-pentyl-1,3-dioxan-4-yl]but-2-enoate (PubChem CID 71725462) has the molecular formula C17H30O4 and a molecular weight of 298.42 g/mol. Its IUPAC name is ethyl (E)-4-[(4S,6R)-2,2-dimethyl-6-pentyl-1,3-dioxan-4-yl]but-2-enoate.
| Compound Name | ethyl (E)-4-[(4S,6R)-2,2-dimethyl-6-pentyl-1,3-dioxan-4-yl]but-2-enoate |
|---|---|
| PubChem CID | 71725462 |
| Molecular Formula | C17H30O4 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | ethyl (E)-4-[(4S,6R)-2,2-dimethyl-6-pentyl-1,3-dioxan-4-yl]but-2-enoate |
| SMILES | CCCCC[C@@H]1C[C@H](C/C=C/C(=O)OCC)OC(C)(C)O1 |
| InChI | InChI=1S/C17H30O4/c1-5-7-8-10-14-13-15(21-17(3,4)20-14)11-9-12-16(18)19-6-2/h9,12,14-15H,5-8,10-11,13H2,1-4H3/b12-9+/t14-,15+/m1/s1 |
| InChIKey | IHHHBLAFAVEFDL-NZETUCKYSA-N |
| XLogP | 3.99 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|