C20H36O3 — CID 122178733
(2R)-2-[(2R)-2-hydroxypentadecyl]-2,3-dihydropyran-6-one (PubChem CID 122178733) has the molecular formula C20H36O3 and a molecular weight of 324.50 g/mol. Its IUPAC name is (2R)-2-[(2R)-2-hydroxypentadecyl]-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-[(2R)-2-hydroxypentadecyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 122178733 |
| Molecular Formula | C20H36O3 |
| Molecular Weight | 324.50 g/mol |
| Exact Mass | 324.27 |
| IUPAC Name | (2R)-2-[(2R)-2-hydroxypentadecyl]-2,3-dihydropyran-6-one |
| SMILES | CCCCCCCCCCCCC[C@@H](O)C[C@H]1CC=CC(=O)O1 |
| InChI | InChI=1S/C20H36O3/c1-2-3-4-5-6-7-8-9-10-11-12-14-18(21)17-19-15-13-16-20(22)23-19/h13,16,18-19,21H,2-12,14-15,17H2,1H3/t18-,19-/m1/s1 |
| InChIKey | INDKJCLBJSOHKB-RTBURBONSA-N |
| XLogP | 5.31 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.50 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|