C26H42O4 — CID 11293015
methyl (2E,6E,10E)-3,7,15-trimethyl-11-(oxan-2-yloxymethyl)hexadeca-2,6,10,14-tetraenoate (PubChem CID 11293015) has the molecular formula C26H42O4 and a molecular weight of 418.62 g/mol. Its IUPAC name is methyl (2E,6E,10E)-3,7,15-trimethyl-11-(oxan-2-yloxymethyl)hexadeca-2,6,10,14-tetraenoate.
| Compound Name | methyl (2E,6E,10E)-3,7,15-trimethyl-11-(oxan-2-yloxymethyl)hexadeca-2,6,10,14-tetraenoate |
|---|---|
| PubChem CID | 11293015 |
| Molecular Formula | C26H42O4 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.31 |
| IUPAC Name | methyl (2E,6E,10E)-3,7,15-trimethyl-11-(oxan-2-yloxymethyl)hexadeca-2,6,10,14-tetraenoate |
| SMILES | COC(=O)/C=C(\C)CC/C=C(\C)CC/C=C(\CCC=C(C)C)COC1CCCCO1 |
| InChI | InChI=1S/C26H42O4/c1-21(2)11-8-15-24(20-30-26-17-6-7-18-29-26)16-10-13-22(3)12-9-14-23(4)19-25(27)28-5/h11-12,16,19,26H,6-10,13-15,17-18,20H2,1-5H3/b22-12+,23-19+,24-16+ |
| InChIKey | JNHMYLNJHZQECK-FCFBBCFRSA-N |
| XLogP | 6.83 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|