C27H49LiO4Sn — CID 10053610
lithium ethyl (2E)-8-(oxan-2-yloxy)-6-tributylstannylocta-2,6-dienoate (PubChem CID 10053610) has the molecular formula C27H49LiO4Sn and a molecular weight of 563.34 g/mol. Its IUPAC name is lithium ethyl (2E)-8-(oxan-2-yloxy)-6-tributylstannylocta-2,6-dienoate.
| Compound Name | lithium ethyl (2E)-8-(oxan-2-yloxy)-6-tributylstannylocta-2,6-dienoate |
|---|---|
| PubChem CID | 10053610 |
| Molecular Formula | C27H49LiO4Sn |
| Molecular Weight | 563.34 g/mol |
| Exact Mass | 564.28 |
| IUPAC Name | lithium ethyl (2E)-8-(oxan-2-yloxy)-6-tributylstannylocta-2,6-dienoate |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(=[C-]/COC1CCCCO1)CC/C=C/C(=O)OCC.[Li+] |
| InChI | InChI=1S/C15H22O4.3C4H9.Li.Sn/c1-2-17-14(16)10-6-4-3-5-8-12-18-15-11-7-9-13-19-15;3*1-3-4-2;;/h6,10,15H,2-4,7,9,11-13H2,1H3;3*1,3-4H2,2H3;;/q-1;;;;+1;/b10-6+;;;;; |
| InChIKey | NVXGLQJHHWRQET-BVIUUAOMSA-N |
| XLogP | 4.55 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.34 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|