C25H46O4Sn — CID 71484355
methyl (2E,5R,6E)-5-(oxan-2-yloxy)-7-tributylstannylhepta-2,6-dienoate (PubChem CID 71484355) has the molecular formula C25H46O4Sn and a molecular weight of 529.35 g/mol. Its IUPAC name is methyl (2E,5R,6E)-5-(oxan-2-yloxy)-7-tributylstannylhepta-2,6-dienoate.
| Compound Name | methyl (2E,5R,6E)-5-(oxan-2-yloxy)-7-tributylstannylhepta-2,6-dienoate |
|---|---|
| PubChem CID | 71484355 |
| Molecular Formula | C25H46O4Sn |
| Molecular Weight | 529.35 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | methyl (2E,5R,6E)-5-(oxan-2-yloxy)-7-tributylstannylhepta-2,6-dienoate |
| SMILES | CCCC[Sn](/C=C/[C@@H](C/C=C/C(=O)OC)OC1CCCCO1)(CCCC)CCCC |
| InChI | InChI=1S/C13H19O4.3C4H9.Sn/c1-3-11(7-6-8-12(14)15-2)17-13-9-4-5-10-16-13;3*1-3-4-2;/h1,3,6,8,11,13H,4-5,7,9-10H2,2H3;3*1,3-4H2,2H3;/b3-1?,8-6+;;;;/t11-,13?;;;;/m0..../s1 |
| InChIKey | HGGHFFONBMVORH-FWLDGSJASA-N |
| XLogP | 6.96 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.35 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|