C14H22N4O2 — CID 103544317
methyl 5-amino-1-(1-azabicyclo[2.2.2]octan-3-yl)-2-ethylimidazole-4-carboxylate (PubChem CID 103544317) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is methyl 5-amino-1-(1-azabicyclo[2.2.2]octan-3-yl)-2-ethylimidazole-4-carboxylate.
| Compound Name | methyl 5-amino-1-(1-azabicyclo[2.2.2]octan-3-yl)-2-ethylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 103544317 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | methyl 5-amino-1-(1-azabicyclo[2.2.2]octan-3-yl)-2-ethylimidazole-4-carboxylate |
| SMILES | CCc1nc(C(=O)OC)c(N)n1C1CN2CCC1CC2 |
| InChI | InChI=1S/C14H22N4O2/c1-3-11-16-12(14(19)20-2)13(15)18(11)10-8-17-6-4-9(10)5-7-17/h9-10H,3-8,15H2,1-2H3 |
| InChIKey | BWRNQBCOUJOKMK-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |