C13H22N4O3 — CID 103545735
methyl 5-amino-2-ethyl-1-[(4-methylmorpholin-2-yl)methyl]imidazole-4-carboxylate (PubChem CID 103545735) has the molecular formula C13H22N4O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is methyl 5-amino-2-ethyl-1-[(4-methylmorpholin-2-yl)methyl]imidazole-4-carboxylate.
| Compound Name | methyl 5-amino-2-ethyl-1-[(4-methylmorpholin-2-yl)methyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 103545735 |
| Molecular Formula | C13H22N4O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | methyl 5-amino-2-ethyl-1-[(4-methylmorpholin-2-yl)methyl]imidazole-4-carboxylate |
| SMILES | CCc1nc(C(=O)OC)c(N)n1CC1CN(C)CCO1 |
| InChI | InChI=1S/C13H22N4O3/c1-4-10-15-11(13(18)19-3)12(14)17(10)8-9-7-16(2)5-6-20-9/h9H,4-8,14H2,1-3H3 |
| InChIKey | JLECIZDHDCFNDF-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |