C13H12F3N3O2 — CID 103545375
methyl 5-amino-2-ethyl-1-(3,4,5-trifluorophenyl)imidazole-4-carboxylate (PubChem CID 103545375) has the molecular formula C13H12F3N3O2 and a molecular weight of 299.25 g/mol. Its IUPAC name is methyl 5-amino-2-ethyl-1-(3,4,5-trifluorophenyl)imidazole-4-carboxylate.
| Compound Name | methyl 5-amino-2-ethyl-1-(3,4,5-trifluorophenyl)imidazole-4-carboxylate |
|---|---|
| PubChem CID | 103545375 |
| Molecular Formula | C13H12F3N3O2 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | methyl 5-amino-2-ethyl-1-(3,4,5-trifluorophenyl)imidazole-4-carboxylate |
| SMILES | CCc1nc(C(=O)OC)c(N)n1-c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C13H12F3N3O2/c1-3-9-18-11(13(20)21-2)12(17)19(9)6-4-7(14)10(16)8(15)5-6/h4-5H,3,17H2,1-2H3 |
| InChIKey | NLQPZQUUTPBEQY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|