C12H17N5O2 — CID 103544795
methyl 5-amino-2-ethyl-1-(1-ethylpyrazol-4-yl)imidazole-4-carboxylate (PubChem CID 103544795) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is methyl 5-amino-2-ethyl-1-(1-ethylpyrazol-4-yl)imidazole-4-carboxylate.
| Compound Name | methyl 5-amino-2-ethyl-1-(1-ethylpyrazol-4-yl)imidazole-4-carboxylate |
|---|---|
| PubChem CID | 103544795 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | methyl 5-amino-2-ethyl-1-(1-ethylpyrazol-4-yl)imidazole-4-carboxylate |
| SMILES | CCc1nc(C(=O)OC)c(N)n1-c1cnn(CC)c1 |
| InChI | InChI=1S/C12H17N5O2/c1-4-9-15-10(12(18)19-3)11(13)17(9)8-6-14-16(5-2)7-8/h6-7H,4-5,13H2,1-3H3 |
| InChIKey | JCSSRCRMKWINGT-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |