C9H11N5O2S — CID 107649031
methyl 5-amino-2-ethyl-1-(thiadiazol-5-yl)imidazole-4-carboxylate (PubChem CID 107649031) has the molecular formula C9H11N5O2S and a molecular weight of 253.29 g/mol. Its IUPAC name is methyl 5-amino-2-ethyl-1-(thiadiazol-5-yl)imidazole-4-carboxylate.
| Compound Name | methyl 5-amino-2-ethyl-1-(thiadiazol-5-yl)imidazole-4-carboxylate |
|---|---|
| PubChem CID | 107649031 |
| Molecular Formula | C9H11N5O2S |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | methyl 5-amino-2-ethyl-1-(thiadiazol-5-yl)imidazole-4-carboxylate |
| SMILES | CCc1nc(C(=O)OC)c(N)n1-c1cnns1 |
| InChI | InChI=1S/C9H11N5O2S/c1-3-5-12-7(9(15)16-2)8(10)14(5)6-4-11-13-17-6/h4H,3,10H2,1-2H3 |
| InChIKey | GJUHQKYWMNATLD-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |