C9H16O4 — CID 103547787
(3R)-3-(oxolan-2-ylmethoxy)butanoic acid (PubChem CID 103547787) has the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. Its IUPAC name is (3R)-3-(oxolan-2-ylmethoxy)butanoic acid.
| Compound Name | (3R)-3-(oxolan-2-ylmethoxy)butanoic acid |
|---|---|
| PubChem CID | 103547787 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | (3R)-3-(oxolan-2-ylmethoxy)butanoic acid |
| SMILES | C[C@H](CC(=O)O)OCC1CCCO1 |
| InChI | InChI=1S/C9H16O4/c1-7(5-9(10)11)13-6-8-3-2-4-12-8/h7-8H,2-6H2,1H3,(H,10,11)/t7-,8?/m1/s1 |
| InChIKey | SRHWTHVUAWGATP-GVHYBUMESA-N |
| XLogP | 1.05 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |