C14H25NO5 — CID 119207645
3-[2-(oxolan-2-ylmethoxy)propanoyl-propan-2-ylamino]propanoic acid (PubChem CID 119207645) has the molecular formula C14H25NO5 and a molecular weight of 287.36 g/mol. Its IUPAC name is 3-[2-(oxolan-2-ylmethoxy)propanoyl-propan-2-ylamino]propanoic acid.
| Compound Name | 3-[2-(oxolan-2-ylmethoxy)propanoyl-propan-2-ylamino]propanoic acid |
|---|---|
| PubChem CID | 119207645 |
| Molecular Formula | C14H25NO5 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 3-[2-(oxolan-2-ylmethoxy)propanoyl-propan-2-ylamino]propanoic acid |
| SMILES | CC(OCC1CCCO1)C(=O)N(CCC(=O)O)C(C)C |
| InChI | InChI=1S/C14H25NO5/c1-10(2)15(7-6-13(16)17)14(18)11(3)20-9-12-5-4-8-19-12/h10-12H,4-9H2,1-3H3,(H,16,17) |
| InChIKey | QHBZWGOLEDPMLJ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |