C14H23NO4S — CID 103550350
3-[2-methoxyethyl(thiolan-3-yl)carbamoyl]cyclopentane-1-carboxylic acid (PubChem CID 103550350) has the molecular formula C14H23NO4S and a molecular weight of 301.41 g/mol. Its IUPAC name is 3-[2-methoxyethyl(thiolan-3-yl)carbamoyl]cyclopentane-1-carboxylic acid.
| Compound Name | 3-[2-methoxyethyl(thiolan-3-yl)carbamoyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 103550350 |
| Molecular Formula | C14H23NO4S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 3-[2-methoxyethyl(thiolan-3-yl)carbamoyl]cyclopentane-1-carboxylic acid |
| SMILES | COCCN(C(=O)C1CCC(C(=O)O)C1)C1CCSC1 |
| InChI | InChI=1S/C14H23NO4S/c1-19-6-5-15(12-4-7-20-9-12)13(16)10-2-3-11(8-10)14(17)18/h10-12H,2-9H2,1H3,(H,17,18) |
| InChIKey | NDEKBWIOUKOOIR-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |