C13H18N2O4S2 — CID 63114405
2-[[2-methoxyethyl(thiolan-3-yl)carbamoyl]amino]thiophene-3-carboxylic acid (PubChem CID 63114405) has the molecular formula C13H18N2O4S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 2-[[2-methoxyethyl(thiolan-3-yl)carbamoyl]amino]thiophene-3-carboxylic acid.
| Compound Name | 2-[[2-methoxyethyl(thiolan-3-yl)carbamoyl]amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 63114405 |
| Molecular Formula | C13H18N2O4S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 2-[[2-methoxyethyl(thiolan-3-yl)carbamoyl]amino]thiophene-3-carboxylic acid |
| SMILES | COCCN(C(=O)Nc1sccc1C(=O)O)C1CCSC1 |
| InChI | InChI=1S/C13H18N2O4S2/c1-19-5-4-15(9-2-6-20-8-9)13(18)14-11-10(12(16)17)3-7-21-11/h3,7,9H,2,4-6,8H2,1H3,(H,14,18)(H,16,17) |
| InChIKey | LXRWSGTYYOODBA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |