C14H14N2O3S2 — CID 63114402
2-[[cyclopropyl(thiophen-3-ylmethyl)carbamoyl]amino]thiophene-3-carboxylic acid (PubChem CID 63114402) has the molecular formula C14H14N2O3S2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 2-[[cyclopropyl(thiophen-3-ylmethyl)carbamoyl]amino]thiophene-3-carboxylic acid.
| Compound Name | 2-[[cyclopropyl(thiophen-3-ylmethyl)carbamoyl]amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 63114402 |
| Molecular Formula | C14H14N2O3S2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 2-[[cyclopropyl(thiophen-3-ylmethyl)carbamoyl]amino]thiophene-3-carboxylic acid |
| SMILES | O=C(O)c1ccsc1NC(=O)N(Cc1ccsc1)C1CC1 |
| InChI | InChI=1S/C14H14N2O3S2/c17-13(18)11-4-6-21-12(11)15-14(19)16(10-1-2-10)7-9-3-5-20-8-9/h3-6,8,10H,1-2,7H2,(H,15,19)(H,17,18) |
| InChIKey | QFHUUFYOYBCULL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |