C8H9NO4S — CID 16772284
2-[(2-methoxyacetyl)amino]thiophene-3-carboxylic acid (PubChem CID 16772284) has the molecular formula C8H9NO4S and a molecular weight of 215.23 g/mol. Its IUPAC name is 2-[(2-methoxyacetyl)amino]thiophene-3-carboxylic acid.
| Compound Name | 2-[(2-methoxyacetyl)amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 16772284 |
| Molecular Formula | C8H9NO4S |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | 2-[(2-methoxyacetyl)amino]thiophene-3-carboxylic acid |
| SMILES | COCC(=O)Nc1sccc1C(=O)O |
| InChI | InChI=1S/C8H9NO4S/c1-13-4-6(10)9-7-5(8(11)12)2-3-14-7/h2-3H,4H2,1H3,(H,9,10)(H,11,12) |
| InChIKey | IRJKECZQRAEGET-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |