C14H13NO5S — CID 43357234
2-[[2-(4-methoxyphenoxy)acetyl]amino]thiophene-3-carboxylic acid (PubChem CID 43357234) has the molecular formula C14H13NO5S and a molecular weight of 307.33 g/mol. Its IUPAC name is 2-[[2-(4-methoxyphenoxy)acetyl]amino]thiophene-3-carboxylic acid.
| Compound Name | 2-[[2-(4-methoxyphenoxy)acetyl]amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 43357234 |
| Molecular Formula | C14H13NO5S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 2-[[2-(4-methoxyphenoxy)acetyl]amino]thiophene-3-carboxylic acid |
| SMILES | COc1ccc(OCC(=O)Nc2sccc2C(=O)O)cc1 |
| InChI | InChI=1S/C14H13NO5S/c1-19-9-2-4-10(5-3-9)20-8-12(16)15-13-11(14(17)18)6-7-21-13/h2-7H,8H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | LOTWPTABTNLHRO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |